C24H27ClN2O2RuS+ — CID 171371308
chlororuthenium(2+);[(1S,2S)-1,2-diphenyl-2-(3-phenylpropylamino)ethyl]-methylsulfonylazanide (PubChem CID 171371308) has the molecular formula C24H27ClN2O2RuS+ and a molecular weight of 544.08 g/mol. Its IUPAC name is chlororuthenium(2+);[(1S,2S)-1,2-diphenyl-2-(3-phenylpropylamino)ethyl]-methylsulfonylazanide.
| Compound Name | chlororuthenium(2+);[(1S,2S)-1,2-diphenyl-2-(3-phenylpropylamino)ethyl]-methylsulfonylazanide |
|---|---|
| PubChem CID | 171371308 |
| Molecular Formula | C24H27ClN2O2RuS+ |
| Molecular Weight | 544.08 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | chlororuthenium(2+);[(1S,2S)-1,2-diphenyl-2-(3-phenylpropylamino)ethyl]-methylsulfonylazanide |
| SMILES | CS(=O)(=O)[N-][C@@H](c1ccccc1)[C@@H](NCCCc1ccccc1)c1ccccc1.Cl[Ru+2] |
| InChI | InChI=1S/C24H27N2O2S.ClH.Ru/c1-29(27,28)26-24(22-17-9-4-10-18-22)23(21-15-7-3-8-16-21)25-19-11-14-20-12-5-2-6-13-20;;/h2-10,12-13,15-18,23-25H,11,14,19H2,1H3;1H;/q-1;;+3/p-1/t23-,24-;;/m0../s1 |
| InChIKey | OCXLTXKWNORCEG-WLKYSPGFSA-M |
| XLogP | 5.71 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.08 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|