C25H29ClN2O2RuS — CID 162710858
carbanide;chlororuthenium(3+);[(1R)-1,2-diphenyl-2-(3-phenylpropylazanidyl)ethyl]-methylsulfonylazanide (PubChem CID 162710858) has the molecular formula C25H29ClN2O2RuS and a molecular weight of 558.11 g/mol. Its IUPAC name is carbanide;chlororuthenium(3+);[(1R)-1,2-diphenyl-2-(3-phenylpropylazanidyl)ethyl]-methylsulfonylazanide.
| Compound Name | carbanide;chlororuthenium(3+);[(1R)-1,2-diphenyl-2-(3-phenylpropylazanidyl)ethyl]-methylsulfonylazanide |
|---|---|
| PubChem CID | 162710858 |
| Molecular Formula | C25H29ClN2O2RuS |
| Molecular Weight | 558.11 g/mol |
| Exact Mass | 558.07 |
| IUPAC Name | carbanide;chlororuthenium(3+);[(1R)-1,2-diphenyl-2-(3-phenylpropylazanidyl)ethyl]-methylsulfonylazanide |
| SMILES | CS(=O)(=O)[N-][C@H](c1ccccc1)C([N-]CCCc1ccccc1)c1ccccc1.Cl[Ru+3].[CH3-] |
| InChI | InChI=1S/C24H26N2O2S.CH3.ClH.Ru/c1-29(27,28)26-24(22-17-9-4-10-18-22)23(21-15-7-3-8-16-21)25-19-11-14-20-12-5-2-6-13-20;;;/h2-10,12-13,15-18,23-24H,11,14,19H2,1H3;1H3;1H;/q-2;-1;;+4/p-1/t23?,24-;;;/m1.../s1 |
| InChIKey | XIHLLVYRDOTLIC-DJKBSXQJSA-M |
| XLogP | 6.95 |
| TPSA | 62.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.11 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|