C26H30ClN2O3RuS — CID 56928567
CID 56928567 (PubChem CID 56928567) has the molecular formula C26H30ClN2O3RuS and a molecular weight of 587.13 g/mol.
| Compound Name | CID 56928567 |
|---|---|
| PubChem CID | 56928567 |
| Molecular Formula | C26H30ClN2O3RuS |
| Molecular Weight | 587.13 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | — |
| SMILES | C[C]1[CH][CH][C](COCC[N-][C@H](c2ccccc2)[C@H]([N-]S(C)(=O)=O)c2ccccc2)[CH][C]1C.[Cl-].[Ru+3] |
| InChI | InChI=1S/C26H30N2O3S.ClH.Ru/c1-20-14-15-22(18-21(20)2)19-31-17-16-27-25(23-10-6-4-7-11-23)26(28-32(3,29)30)24-12-8-5-9-13-24;;/h4-15,18,25-26H,16-17,19H2,1-3H3;1H;/q-2;;+3/p-1/t25-,26-;;/m1../s1 |
| InChIKey | KOTMDFOQGLTGLZ-KUSCCAPHSA-M |
| XLogP | 2.58 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.13 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|