C23H27N2O2S- — CID 122494985
[(1R)-1-(3-cyclohexa-1,4-dien-1-ylpropylamino)-2-phenyl-2-(sulfinatoamino)ethyl]benzene (PubChem CID 122494985) has the molecular formula C23H27N2O2S- and a molecular weight of 395.55 g/mol. Its IUPAC name is [(1R)-1-(3-cyclohexa-1,4-dien-1-ylpropylamino)-2-phenyl-2-(sulfinatoamino)ethyl]benzene.
| Compound Name | [(1R)-1-(3-cyclohexa-1,4-dien-1-ylpropylamino)-2-phenyl-2-(sulfinatoamino)ethyl]benzene |
|---|---|
| PubChem CID | 122494985 |
| Molecular Formula | C23H27N2O2S- |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [(1R)-1-(3-cyclohexa-1,4-dien-1-ylpropylamino)-2-phenyl-2-(sulfinatoamino)ethyl]benzene |
| SMILES | O=S([O-])NC(c1ccccc1)[C@H](NCCCC1=CCC=CC1)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O2S/c26-28(27)25-23(21-16-8-3-9-17-21)22(20-14-6-2-7-15-20)24-18-10-13-19-11-4-1-5-12-19/h1-4,6-9,12,14-17,22-25H,5,10-11,13,18H2,(H,26,27)/p-1/t22-,23?/m1/s1 |
| InChIKey | WYYDGESVALIUAS-WTQRLHSKSA-M |
| XLogP | 4.50 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|