C22H25NO3S — CID 11176552
2-cyclohexa-1,4-dien-1-yl-N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]ethanesulfonamide (PubChem CID 11176552) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is 2-cyclohexa-1,4-dien-1-yl-N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]ethanesulfonamide.
| Compound Name | 2-cyclohexa-1,4-dien-1-yl-N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 11176552 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-cyclohexa-1,4-dien-1-yl-N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCC1=CCC=CC1)N[C@@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C22H25NO3S/c24-22(20-14-8-3-9-15-20)21(19-12-6-2-7-13-19)23-27(25,26)17-16-18-10-4-1-5-11-18/h1-4,6-9,11-15,21-24H,5,10,16-17H2/t21-,22+/m0/s1 |
| InChIKey | LOBJPOQOWYUEOY-FCHUYYIVSA-N |
| XLogP | 4.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|