C18H24N2O4S2 — CID 110299331
N,N-dimethyl-4-[2-(1-phenylethylsulfamoyl)ethyl]benzenesulfonamide (PubChem CID 110299331) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(1-phenylethylsulfamoyl)ethyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[2-(1-phenylethylsulfamoyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110299331 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N,N-dimethyl-4-[2-(1-phenylethylsulfamoyl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)CCc1ccc(S(=O)(=O)N(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O4S2/c1-15(17-7-5-4-6-8-17)19-25(21,22)14-13-16-9-11-18(12-10-16)26(23,24)20(2)3/h4-12,15,19H,13-14H2,1-3H3 |
| InChIKey | OKPHYFCAKZLFOK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |