C18H24N2O3S — CID 110907925
4-[1-[4-(2-hydroxyethyl)anilino]ethyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 110907925) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 4-[1-[4-(2-hydroxyethyl)anilino]ethyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[1-[4-(2-hydroxyethyl)anilino]ethyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110907925 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 4-[1-[4-(2-hydroxyethyl)anilino]ethyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CC(Nc1ccc(CCO)cc1)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C18H24N2O3S/c1-14(19-17-8-4-15(5-9-17)12-13-21)16-6-10-18(11-7-16)24(22,23)20(2)3/h4-11,14,19,21H,12-13H2,1-3H3 |
| InChIKey | JBPKWMOJPFUEEC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |