C26H31N3O5S2 — CID 133239103
N-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-[4-(1-phenylethylsulfamoyl)phenyl]propanamide (PubChem CID 133239103) has the molecular formula C26H31N3O5S2 and a molecular weight of 529.68 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-[4-(1-phenylethylsulfamoyl)phenyl]propanamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-[4-(1-phenylethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 133239103 |
| Molecular Formula | C26H31N3O5S2 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-[4-(1-phenylethylsulfamoyl)phenyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)CCc1ccc(S(=O)(=O)NC(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H31N3O5S2/c1-19-10-14-24(36(33,34)29(3)4)18-25(19)27-26(30)17-13-21-11-15-23(16-12-21)35(31,32)28-20(2)22-8-6-5-7-9-22/h5-12,14-16,18,20,28H,13,17H2,1-4H3,(H,27,30) |
| InChIKey | POGMPZAZEWVWPN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |