C25H26N2O5S — CID 2211920
methyl 2-[3-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]propanoylamino]benzoate (PubChem CID 2211920) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is methyl 2-[3-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]propanoylamino]benzoate.
| Compound Name | methyl 2-[3-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 2211920 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | methyl 2-[3-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]propanoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CCc1ccc(S(=O)(=O)N[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N2O5S/c1-18(20-8-4-3-5-9-20)27-33(30,31)21-15-12-19(13-16-21)14-17-24(28)26-23-11-7-6-10-22(23)25(29)32-2/h3-13,15-16,18,27H,14,17H2,1-2H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | AHPKNDZWPUTLLW-GOSISDBHSA-N |
| XLogP | 4.08 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |