C39H52N2OS — CID 130468488
N-[(1S,2S)-2-(4-cyclohexa-1,4-dien-1-ylbutylamino)-1,2-diphenylethyl]-2,4,6-tri(propan-2-yl)benzenesulfinamide (PubChem CID 130468488) has the molecular formula C39H52N2OS and a molecular weight of 596.93 g/mol. Its IUPAC name is N-[(1S,2S)-2-(4-cyclohexa-1,4-dien-1-ylbutylamino)-1,2-diphenylethyl]-2,4,6-tri(propan-2-yl)benzenesulfinamide.
| Compound Name | N-[(1S,2S)-2-(4-cyclohexa-1,4-dien-1-ylbutylamino)-1,2-diphenylethyl]-2,4,6-tri(propan-2-yl)benzenesulfinamide |
|---|---|
| PubChem CID | 130468488 |
| Molecular Formula | C39H52N2OS |
| Molecular Weight | 596.93 g/mol |
| Exact Mass | 596.38 |
| IUPAC Name | N-[(1S,2S)-2-(4-cyclohexa-1,4-dien-1-ylbutylamino)-1,2-diphenylethyl]-2,4,6-tri(propan-2-yl)benzenesulfinamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)N[C@@H](c2ccccc2)[C@@H](NCCCCC2=CCC=CC2)c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C39H52N2OS/c1-28(2)34-26-35(29(3)4)39(36(27-34)30(5)6)43(42)41-38(33-23-14-9-15-24-33)37(32-21-12-8-13-22-32)40-25-17-16-20-31-18-10-7-11-19-31/h7-10,12-15,19,21-24,26-30,37-38,40-41H,11,16-18,20,25H2,1-6H3/t37-,38-,43?/m0/s1 |
| InChIKey | UQPUAGUKAWAYAZ-AHIHYCLQSA-N |
| XLogP | 10.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.93 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|