C26H40N2O3S — CID 118962368
2-amino-N-(3-cyclohexa-1,4-dien-1-ylpropyl)-2-[2,4,6-tri(propan-2-yl)phenyl]sulfonylacetamide (PubChem CID 118962368) has the molecular formula C26H40N2O3S and a molecular weight of 460.68 g/mol. Its IUPAC name is 2-amino-N-(3-cyclohexa-1,4-dien-1-ylpropyl)-2-[2,4,6-tri(propan-2-yl)phenyl]sulfonylacetamide.
| Compound Name | 2-amino-N-(3-cyclohexa-1,4-dien-1-ylpropyl)-2-[2,4,6-tri(propan-2-yl)phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 118962368 |
| Molecular Formula | C26H40N2O3S |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 2-amino-N-(3-cyclohexa-1,4-dien-1-ylpropyl)-2-[2,4,6-tri(propan-2-yl)phenyl]sulfonylacetamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)C(N)C(=O)NCCCC2=CCC=CC2)c(C(C)C)c1 |
| InChI | InChI=1S/C26H40N2O3S/c1-17(2)21-15-22(18(3)4)24(23(16-21)19(5)6)32(30,31)25(27)26(29)28-14-10-13-20-11-8-7-9-12-20/h7-8,12,15-19,25H,9-11,13-14,27H2,1-6H3,(H,28,29) |
| InChIKey | WXCYZLYNKWVYBL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|