C18H30ClNO2S — CID 3407313
N-(3-chloropropyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 3407313) has the molecular formula C18H30ClNO2S and a molecular weight of 359.96 g/mol. Its IUPAC name is N-(3-chloropropyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-(3-chloropropyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3407313 |
| Molecular Formula | C18H30ClNO2S |
| Molecular Weight | 359.96 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-(3-chloropropyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)NCCCCl)c(C(C)C)c1 |
| InChI | InChI=1S/C18H30ClNO2S/c1-12(2)15-10-16(13(3)4)18(17(11-15)14(5)6)23(21,22)20-9-7-8-19/h10-14,20H,7-9H2,1-6H3 |
| InChIKey | DURJNFBRBVDQEM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.96 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|