C21H36N2O3S — CID 2213229
N'-[2,4,6-tri(propan-2-yl)phenyl]sulfonylhexanehydrazide (PubChem CID 2213229) has the molecular formula C21H36N2O3S and a molecular weight of 396.60 g/mol. Its IUPAC name is N'-[2,4,6-tri(propan-2-yl)phenyl]sulfonylhexanehydrazide.
| Compound Name | N'-[2,4,6-tri(propan-2-yl)phenyl]sulfonylhexanehydrazide |
|---|---|
| PubChem CID | 2213229 |
| Molecular Formula | C21H36N2O3S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | N'-[2,4,6-tri(propan-2-yl)phenyl]sulfonylhexanehydrazide |
| SMILES | CCCCCC(=O)NNS(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C21H36N2O3S/c1-8-9-10-11-20(24)22-23-27(25,26)21-18(15(4)5)12-17(14(2)3)13-19(21)16(6)7/h12-16,23H,8-11H2,1-7H3,(H,22,24) |
| InChIKey | PYYJWHLBONABPT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|