C38H54N4O4S — CID 70485684
N-[2-[4-[acetyl(methyl)amino]anilino]-5-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]octanamide (PubChem CID 70485684) has the molecular formula C38H54N4O4S and a molecular weight of 662.94 g/mol. Its IUPAC name is N-[2-[4-[acetyl(methyl)amino]anilino]-5-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]octanamide.
| Compound Name | N-[2-[4-[acetyl(methyl)amino]anilino]-5-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]octanamide |
|---|---|
| PubChem CID | 70485684 |
| Molecular Formula | C38H54N4O4S |
| Molecular Weight | 662.94 g/mol |
| Exact Mass | 662.39 |
| IUPAC Name | N-[2-[4-[acetyl(methyl)amino]anilino]-5-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1cc(NS(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)ccc1Nc1ccc(N(C)C(C)=O)cc1 |
| InChI | InChI=1S/C38H54N4O4S/c1-10-11-12-13-14-15-37(44)40-36-24-31(18-21-35(36)39-30-16-19-32(20-17-30)42(9)28(8)43)41-47(45,46)38-33(26(4)5)22-29(25(2)3)23-34(38)27(6)7/h16-27,39,41H,10-15H2,1-9H3,(H,40,44) |
| InChIKey | BYEHUYXPXLZVOM-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.94 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|