C23H33NO2S — CID 2058209
N-(2,5-dimethylphenyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 2058209) has the molecular formula C23H33NO2S and a molecular weight of 387.59 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-(2,5-dimethylphenyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 2058209 |
| Molecular Formula | C23H33NO2S |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c1 |
| InChI | InChI=1S/C23H33NO2S/c1-14(2)19-12-20(15(3)4)23(21(13-19)16(5)6)27(25,26)24-22-11-17(7)9-10-18(22)8/h9-16,24H,1-8H3 |
| InChIKey | COJYIFKJMHOZJL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |