C39H52N2O2S — CID 118962387
2-[(3S,4S)-4-(4-cyclohexa-1,4-dien-1-ylbutylamino)-2-methyl-3,4-diphenylbutan-2-yl]-4,6-di(propan-2-yl)benzenesulfonamide (PubChem CID 118962387) has the molecular formula C39H52N2O2S and a molecular weight of 612.92 g/mol. Its IUPAC name is 2-[(3S,4S)-4-(4-cyclohexa-1,4-dien-1-ylbutylamino)-2-methyl-3,4-diphenylbutan-2-yl]-4,6-di(propan-2-yl)benzenesulfonamide.
| Compound Name | 2-[(3S,4S)-4-(4-cyclohexa-1,4-dien-1-ylbutylamino)-2-methyl-3,4-diphenylbutan-2-yl]-4,6-di(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118962387 |
| Molecular Formula | C39H52N2O2S |
| Molecular Weight | 612.92 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | 2-[(3S,4S)-4-(4-cyclohexa-1,4-dien-1-ylbutylamino)-2-methyl-3,4-diphenylbutan-2-yl]-4,6-di(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(N)(=O)=O)c(C(C)(C)[C@H](c2ccccc2)[C@H](NCCCCC2=CCC=CC2)c2ccccc2)c1 |
| InChI | InChI=1S/C39H52N2O2S/c1-28(2)33-26-34(29(3)4)38(44(40,42)43)35(27-33)39(5,6)36(31-21-12-8-13-22-31)37(32-23-14-9-15-24-32)41-25-17-16-20-30-18-10-7-11-19-30/h7-10,12-15,19,21-24,26-29,36-37,41H,11,16-18,20,25H2,1-6H3,(H2,40,42,43)/t36-,37-/m1/s1 |
| InChIKey | DDPQLRPDIHFBDU-FZNHDDJXSA-N |
| XLogP | 9.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.92 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|