C19H28N2O — CID 123820541
1-N-[2-[(5-methylcyclohexa-1,4-dien-1-yl)methoxy]ethyl]-1-phenylpropane-1,2-diamine (PubChem CID 123820541) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-N-[2-[(5-methylcyclohexa-1,4-dien-1-yl)methoxy]ethyl]-1-phenylpropane-1,2-diamine.
| Compound Name | 1-N-[2-[(5-methylcyclohexa-1,4-dien-1-yl)methoxy]ethyl]-1-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 123820541 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 1-N-[2-[(5-methylcyclohexa-1,4-dien-1-yl)methoxy]ethyl]-1-phenylpropane-1,2-diamine |
| SMILES | CC1=CCC=C(COCCNC(c2ccccc2)C(C)N)C1 |
| InChI | InChI=1S/C19H28N2O/c1-15-7-6-8-17(13-15)14-22-12-11-21-19(16(2)20)18-9-4-3-5-10-18/h3-5,7-10,16,19,21H,6,11-14,20H2,1-2H3 |
| InChIKey | OUEQYAIBMZPIBQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|