C19H26N2O — CID 70143967
(2R,3S)-3-amino-1-[2-(4-methylphenyl)ethylamino]-1-phenylbutan-2-ol (PubChem CID 70143967) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-[2-(4-methylphenyl)ethylamino]-1-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-amino-1-[2-(4-methylphenyl)ethylamino]-1-phenylbutan-2-ol |
|---|---|
| PubChem CID | 70143967 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (2R,3S)-3-amino-1-[2-(4-methylphenyl)ethylamino]-1-phenylbutan-2-ol |
| SMILES | Cc1ccc(CCNC(c2ccccc2)[C@H](O)[C@H](C)N)cc1 |
| InChI | InChI=1S/C19H26N2O/c1-14-8-10-16(11-9-14)12-13-21-18(19(22)15(2)20)17-6-4-3-5-7-17/h3-11,15,18-19,21-22H,12-13,20H2,1-2H3/t15-,18?,19+/m0/s1 |
| InChIKey | IGUXQFLXAPUDPG-JMRRQPBMSA-N |
| XLogP | 2.58 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |