C23H24N2O — CID 108867607
1-benzhydryl-3-[2-(4-methylphenyl)ethyl]urea (PubChem CID 108867607) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-benzhydryl-3-[2-(4-methylphenyl)ethyl]urea.
| Compound Name | 1-benzhydryl-3-[2-(4-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108867607 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 1-benzhydryl-3-[2-(4-methylphenyl)ethyl]urea |
| SMILES | Cc1ccc(CCNC(=O)NC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O/c1-18-12-14-19(15-13-18)16-17-24-23(26)25-22(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,22H,16-17H2,1H3,(H2,24,25,26) |
| InChIKey | GCKBRKLVFHDCTJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |