C20H20N2O2 — CID 71798567
1-benzhydryl-3-[2-(furan-3-yl)ethyl]urea (PubChem CID 71798567) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-benzhydryl-3-[2-(furan-3-yl)ethyl]urea.
| Compound Name | 1-benzhydryl-3-[2-(furan-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 71798567 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-benzhydryl-3-[2-(furan-3-yl)ethyl]urea |
| SMILES | O=C(NCCc1ccoc1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O2/c23-20(21-13-11-16-12-14-24-15-16)22-19(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,12,14-15,19H,11,13H2,(H2,21,22,23) |
| InChIKey | OTNVGQDJULSODO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |