C13H24 — CID 101214135
(3S,4S)-3,4-dimethyl-1,2-dipropylcyclopentene (PubChem CID 101214135) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is (3S,4S)-3,4-dimethyl-1,2-dipropylcyclopentene.
| Compound Name | (3S,4S)-3,4-dimethyl-1,2-dipropylcyclopentene |
|---|---|
| PubChem CID | 101214135 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (3S,4S)-3,4-dimethyl-1,2-dipropylcyclopentene |
| SMILES | CCCC1=C(CCC)[C@@H](C)[C@@H](C)C1 |
| InChI | InChI=1S/C13H24/c1-5-7-12-9-10(3)11(4)13(12)8-6-2/h10-11H,5-9H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | JKIBTLPJLQZKBA-QWRGUYRKSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|