C11H19P — CID 143728382
(5,6-dimethyl-2-propylcyclohexa-2,4-dien-1-yl)phosphane (PubChem CID 143728382) has the molecular formula C11H19P and a molecular weight of 182.25 g/mol. Its IUPAC name is (5,6-dimethyl-2-propylcyclohexa-2,4-dien-1-yl)phosphane.
| Compound Name | (5,6-dimethyl-2-propylcyclohexa-2,4-dien-1-yl)phosphane |
|---|---|
| PubChem CID | 143728382 |
| Molecular Formula | C11H19P |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (5,6-dimethyl-2-propylcyclohexa-2,4-dien-1-yl)phosphane |
| SMILES | CCCC1=CC=C(C)C(C)C1P |
| InChI | InChI=1S/C11H19P/c1-4-5-10-7-6-8(2)9(3)11(10)12/h6-7,9,11H,4-5,12H2,1-3H3 |
| InChIKey | DQWWTZZDWHUCPI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|