C10H18BBr — CID 125480410
1-bromo-4,5-dipropyl-2,3-dihydroborole (PubChem CID 125480410) has the molecular formula C10H18BBr and a molecular weight of 228.97 g/mol. Its IUPAC name is 1-bromo-4,5-dipropyl-2,3-dihydroborole.
| Compound Name | 1-bromo-4,5-dipropyl-2,3-dihydroborole |
|---|---|
| PubChem CID | 125480410 |
| Molecular Formula | C10H18BBr |
| Molecular Weight | 228.97 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1-bromo-4,5-dipropyl-2,3-dihydroborole |
| SMILES | CCCC1=C(CCC)B(Br)CC1 |
| InChI | InChI=1S/C10H18BBr/c1-3-5-9-7-8-11(12)10(9)6-4-2/h3-8H2,1-2H3 |
| InChIKey | DXHWFWAVYHBNAQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.97 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|