C15H24 — CID 102100274
1,3-dipropyl-4,5,6,7-tetrahydro-2H-indene (PubChem CID 102100274) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 1,3-dipropyl-4,5,6,7-tetrahydro-2H-indene.
| Compound Name | 1,3-dipropyl-4,5,6,7-tetrahydro-2H-indene |
|---|---|
| PubChem CID | 102100274 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 1,3-dipropyl-4,5,6,7-tetrahydro-2H-indene |
| SMILES | CCCC1=C2CCCCC2=C(CCC)C1 |
| InChI | InChI=1S/C15H24/c1-3-7-12-11-13(8-4-2)15-10-6-5-9-14(12)15/h3-11H2,1-2H3 |
| InChIKey | ZIVDGTRXMNVCIQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |