C18H24N2 — CID 101357517
1,4-dipropyl-2,3,5,6,7,8-hexahydronaphthalene-2,3-dicarbonitrile (PubChem CID 101357517) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1,4-dipropyl-2,3,5,6,7,8-hexahydronaphthalene-2,3-dicarbonitrile.
| Compound Name | 1,4-dipropyl-2,3,5,6,7,8-hexahydronaphthalene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 101357517 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1,4-dipropyl-2,3,5,6,7,8-hexahydronaphthalene-2,3-dicarbonitrile |
| SMILES | CCCC1=C2CCCCC2=C(CCC)C(C#N)C1C#N |
| InChI | InChI=1S/C18H24N2/c1-3-7-13-15-9-5-6-10-16(15)14(8-4-2)18(12-20)17(13)11-19/h17-18H,3-10H2,1-2H3 |
| InChIKey | LDESTEDGSDEXQF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |