About (5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile
(5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile (PubChem CID 99864946) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is (5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile.
Analyze (5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The IUPAC name of (5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile (CID 99864946) is (5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile.
What is the SMILES notation for (5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The canonical SMILES for (5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile is CCCC1=NO[C@H](C#N)C1.
What is the InChIKey of (5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The InChIKey is MPESYEXRHUVKHQ-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H10N2O/c1-2-3-6-4-7(5-8)10-9-6/h7H,2-4H2,1H3/t7-/m0/s1.
What are the key properties of (5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile?
(5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile has a molecular weight of 138.17 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3-propyl-4,5-dihydro-1,2-oxazole-5-carbonitrile is sourced from PubChem (CID 99864946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).