About ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene
ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene (PubChem CID 142361347) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene.
Analyze ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene?
The IUPAC name of ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene (CID 142361347) is ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene.
What is the SMILES notation for ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene?
The canonical SMILES for ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene is CC.CCCC1=CC(CC)=CC(C)C1.
What is the InChIKey of ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene?
The InChIKey is RPIHORYYDAFIOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20.C2H6/c1-4-6-12-8-10(3)7-11(5-2)9-12;1-2/h7,9-10H,4-6,8H2,1-3H3;1-2H3.
What are the key properties of ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene?
ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene has a molecular weight of 194.36 g/mol, XLogP of 5.12, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-5-methyl-1-propylcyclohexa-1,3-diene is sourced from PubChem (CID 142361347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).