C8H10O — CID 134894419
(1S,4R,7S)-7-methylbicyclo[2.2.1]hepta-2,5-dien-2-ol (PubChem CID 134894419) has the molecular formula C8H10O and a molecular weight of 122.17 g/mol. Its IUPAC name is (1S,4R,7S)-7-methylbicyclo[2.2.1]hepta-2,5-dien-2-ol.
| Compound Name | (1S,4R,7S)-7-methylbicyclo[2.2.1]hepta-2,5-dien-2-ol |
|---|---|
| PubChem CID | 134894419 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | (1S,4R,7S)-7-methylbicyclo[2.2.1]hepta-2,5-dien-2-ol |
| SMILES | C[C@H]1[C@H]2C=C[C@@H]1C(O)=C2 |
| InChI | InChI=1S/C8H10O/c1-5-6-2-3-7(5)8(9)4-6/h2-7,9H,1H3/t5-,6-,7-/m0/s1 |
| InChIKey | GMJLDVFALYRZEN-ACZMJKKPSA-N |
| XLogP | 1.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|