C20H18 — CID 125036364
(1R,4R,7R,10R)-2-[(1R,4S,7S,10S)-2-tricyclo[5.2.1.04,10]deca-2,5,8-trienyl]tricyclo[5.2.1.04,10]deca-2,5,8-triene (PubChem CID 125036364) has the molecular formula C20H18 and a molecular weight of 258.36 g/mol. Its IUPAC name is (1R,4R,7R,10R)-2-[(1R,4S,7S,10S)-2-tricyclo[5.2.1.04,10]deca-2,5,8-trienyl]tricyclo[5.2.1.04,10]deca-2,5,8-triene.
| Compound Name | (1R,4R,7R,10R)-2-[(1R,4S,7S,10S)-2-tricyclo[5.2.1.04,10]deca-2,5,8-trienyl]tricyclo[5.2.1.04,10]deca-2,5,8-triene |
|---|---|
| PubChem CID | 125036364 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (1R,4R,7R,10R)-2-[(1R,4S,7S,10S)-2-tricyclo[5.2.1.04,10]deca-2,5,8-trienyl]tricyclo[5.2.1.04,10]deca-2,5,8-triene |
| SMILES | C1=C[C@H]2C=C(C3=C[C@H]4C=C[C@H]5C=C[C@@H]3[C@@H]54)[C@@H]3C=C[C@@H]1[C@H]23 |
| InChI | InChI=1S/C20H18/c1-3-13-9-17(15-7-5-11(1)19(13)15)18-10-14-4-2-12-6-8-16(18)20(12)14/h1-16,19-20H/t11-,12+,13+,14-,15-,16-,19-,20+/m0/s1 |
| InChIKey | VWAWVLPZRWQIJZ-WHHPSKPUSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|