C21H27NO — CID 98555724
(1S,4R,7S,10S)-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]tricyclo[5.2.1.04,10]deca-2,5,8-triene-2-carboxamide (PubChem CID 98555724) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (1S,4R,7S,10S)-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]tricyclo[5.2.1.04,10]deca-2,5,8-triene-2-carboxamide.
| Compound Name | (1S,4R,7S,10S)-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]tricyclo[5.2.1.04,10]deca-2,5,8-triene-2-carboxamide |
|---|---|
| PubChem CID | 98555724 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (1S,4R,7S,10S)-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]tricyclo[5.2.1.04,10]deca-2,5,8-triene-2-carboxamide |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)[C@H](NC(=O)C1=C[C@@H]3C=C[C@H]4C=C[C@H]1[C@@H]43)C2 |
| InChI | InChI=1S/C21H27NO/c1-20(2)14-8-9-21(20,3)17(11-14)22-19(23)16-10-13-5-4-12-6-7-15(16)18(12)13/h4-7,10,12-15,17-18H,8-9,11H2,1-3H3,(H,22,23)/t12-,13-,14+,15+,17+,18-,21+/m0/s1 |
| InChIKey | NEXIGXOTTLWWTF-KEILLJCTSA-N |
| XLogP | 3.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|