C17H22INO — CID 60629735
4-iodo-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzamide (PubChem CID 60629735) has the molecular formula C17H22INO and a molecular weight of 383.27 g/mol. Its IUPAC name is 4-iodo-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzamide.
| Compound Name | 4-iodo-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzamide |
|---|---|
| PubChem CID | 60629735 |
| Molecular Formula | C17H22INO |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 4-iodo-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzamide |
| SMILES | CC1(C)C2CCC1(C)C(NC(=O)c1ccc(I)cc1)C2 |
| InChI | InChI=1S/C17H22INO/c1-16(2)12-8-9-17(16,3)14(10-12)19-15(20)11-4-6-13(18)7-5-11/h4-7,12,14H,8-10H2,1-3H3,(H,19,20) |
| InChIKey | LZPMDVIKZZJAAD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|