C19H24N4O2 — CID 49124609
1-[(4-cyanobenzoyl)amino]-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)urea (PubChem CID 49124609) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-[(4-cyanobenzoyl)amino]-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)urea.
| Compound Name | 1-[(4-cyanobenzoyl)amino]-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)urea |
|---|---|
| PubChem CID | 49124609 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-[(4-cyanobenzoyl)amino]-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)urea |
| SMILES | CC1(C)C2CCC1(C)C(NC(=O)NNC(=O)c1ccc(C#N)cc1)C2 |
| InChI | InChI=1S/C19H24N4O2/c1-18(2)14-8-9-19(18,3)15(10-14)21-17(25)23-22-16(24)13-6-4-12(11-20)5-7-13/h4-7,14-15H,8-10H2,1-3H3,(H,22,24)(H2,21,23,25) |
| InChIKey | RUUZFJQWMQAFPH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|