C12H12 — CID 101404891
(2S,5S,8R,11R)-tetracyclo[6.3.1.02,11.05,12]dodeca-3,6,9-triene (PubChem CID 101404891) has the molecular formula C12H12 and a molecular weight of 156.23 g/mol. Its IUPAC name is (2S,5S,8R,11R)-tetracyclo[6.3.1.02,11.05,12]dodeca-3,6,9-triene.
| Compound Name | (2S,5S,8R,11R)-tetracyclo[6.3.1.02,11.05,12]dodeca-3,6,9-triene |
|---|---|
| PubChem CID | 101404891 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (2S,5S,8R,11R)-tetracyclo[6.3.1.02,11.05,12]dodeca-3,6,9-triene |
| SMILES | C1=CC2C=CC3C4C=CC1C2C43 |
| InChI | InChI=1S/C12H12/c1-2-8-4-6-10-9-5-3-7(1)11(8)12(9)10/h1-12H |
| InChIKey | KOFUSYLLQUHVFO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|