C18H18O2 — CID 99958168
(1R,3R)-2-[(1S,3S)-2-hydroxy-2-tricyclo[4.2.1.03,9]nona-4,7-dienyl]tricyclo[4.2.1.03,9]nona-4,7-dien-2-ol (PubChem CID 99958168) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R,3R)-2-[(1S,3S)-2-hydroxy-2-tricyclo[4.2.1.03,9]nona-4,7-dienyl]tricyclo[4.2.1.03,9]nona-4,7-dien-2-ol.
| Compound Name | (1R,3R)-2-[(1S,3S)-2-hydroxy-2-tricyclo[4.2.1.03,9]nona-4,7-dienyl]tricyclo[4.2.1.03,9]nona-4,7-dien-2-ol |
|---|---|
| PubChem CID | 99958168 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (1R,3R)-2-[(1S,3S)-2-hydroxy-2-tricyclo[4.2.1.03,9]nona-4,7-dienyl]tricyclo[4.2.1.03,9]nona-4,7-dien-2-ol |
| SMILES | OC1(C2(O)[C@H]3C=CC4C=C[C@H]2C43)[C@@H]2C=CC3C=C[C@@H]1C32 |
| InChI | InChI=1S/C18H18O2/c19-17(11-5-1-9-2-6-12(17)15(9)11)18(20)13-7-3-10-4-8-14(18)16(10)13/h1-16,19-20H/t9?,10?,11-,12-,13+,14+,15?,16?,17?,18? |
| InChIKey | YEIRPFJKGOBAFF-MJICYONXSA-N |
| XLogP | 1.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|