C20H22O2 — CID 124802180
(1S,2S,4R,7R,10R)-2-[(1R,2R,4R,7R,10R)-2-hydroxy-2-tricyclo[5.2.1.04,10]deca-5,8-dienyl]tricyclo[5.2.1.04,10]deca-5,8-dien-2-ol (PubChem CID 124802180) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (1S,2S,4R,7R,10R)-2-[(1R,2R,4R,7R,10R)-2-hydroxy-2-tricyclo[5.2.1.04,10]deca-5,8-dienyl]tricyclo[5.2.1.04,10]deca-5,8-dien-2-ol.
| Compound Name | (1S,2S,4R,7R,10R)-2-[(1R,2R,4R,7R,10R)-2-hydroxy-2-tricyclo[5.2.1.04,10]deca-5,8-dienyl]tricyclo[5.2.1.04,10]deca-5,8-dien-2-ol |
|---|---|
| PubChem CID | 124802180 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (1S,2S,4R,7R,10R)-2-[(1R,2R,4R,7R,10R)-2-hydroxy-2-tricyclo[5.2.1.04,10]deca-5,8-dienyl]tricyclo[5.2.1.04,10]deca-5,8-dien-2-ol |
| SMILES | O[C@]1([C@]2(O)C[C@@H]3C=C[C@@H]4C=C[C@H]2[C@@H]43)C[C@@H]2C=C[C@@H]3C=C[C@@H]1[C@@H]32 |
| InChI | InChI=1S/C20H22O2/c21-19(9-13-3-1-11-5-7-15(19)17(11)13)20(22)10-14-4-2-12-6-8-16(20)18(12)14/h1-8,11-18,21-22H,9-10H2/t11-,12-,13+,14+,15-,16+,17+,18+,19-,20+/m1/s1 |
| InChIKey | MZOLIDFXFPSKBQ-GOAGHXCNSA-N |
| XLogP | 2.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|