C20H20 — CID 102306199
(2R,7S,9R,14S)-hexacyclo[6.6.2.23,6.210,13.02,7.09,14]icosa-4,11,15,17,19-pentaene (PubChem CID 102306199) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is (2R,7S,9R,14S)-hexacyclo[6.6.2.23,6.210,13.02,7.09,14]icosa-4,11,15,17,19-pentaene.
| Compound Name | (2R,7S,9R,14S)-hexacyclo[6.6.2.23,6.210,13.02,7.09,14]icosa-4,11,15,17,19-pentaene |
|---|---|
| PubChem CID | 102306199 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (2R,7S,9R,14S)-hexacyclo[6.6.2.23,6.210,13.02,7.09,14]icosa-4,11,15,17,19-pentaene |
| SMILES | C1=CC2C=CC1C1C3C=CC(C21)C1C2C=CC(C=C2)C31 |
| InChI | InChI=1S/C20H20/c1-2-12-4-3-11(1)17-15-9-10-16(18(12)17)20-14-7-5-13(6-8-14)19(15)20/h1-20H |
| InChIKey | XLEFWUMCRIEPQL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|