C17H16Cl2 — CID 129431343
(1S,2S,3R,4R,5S,6R,8R,9S,10S,11R,12R,13R,14S,15S)-7,7-dichlorooctacyclo[8.7.0.02,14.03,13.04,9.05,12.06,8.011,15]heptadec-16-ene (PubChem CID 129431343) has the molecular formula C17H16Cl2 and a molecular weight of 291.22 g/mol. Its IUPAC name is (1S,2S,3R,4R,5S,6R,8R,9S,10S,11R,12R,13R,14S,15S)-7,7-dichlorooctacyclo[8.7.0.02,14.03,13.04,9.05,12.06,8.011,15]heptadec-16-ene.
| Compound Name | (1S,2S,3R,4R,5S,6R,8R,9S,10S,11R,12R,13R,14S,15S)-7,7-dichlorooctacyclo[8.7.0.02,14.03,13.04,9.05,12.06,8.011,15]heptadec-16-ene |
|---|---|
| PubChem CID | 129431343 |
| Molecular Formula | C17H16Cl2 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (1S,2S,3R,4R,5S,6R,8R,9S,10S,11R,12R,13R,14S,15S)-7,7-dichlorooctacyclo[8.7.0.02,14.03,13.04,9.05,12.06,8.011,15]heptadec-16-ene |
| SMILES | ClC1(Cl)[C@@H]2[C@H]3[C@@H]4[C@@H]5[C@H]6C=C[C@H]7[C@H]8[C@H]6[C@@H]4[C@@H]8[C@@H]3[C@H]([C@@H]75)[C@H]21 |
| InChI | InChI=1S/C17H16Cl2/c18-17(19)15-13-8-4-2-1-3-5-6(4)10-9(5)11(7(3)8)14(12(10)13)16(15)17/h1-16H/t3-,4-,5-,6-,7+,8-,9+,10+,11+,12+,13-,14-,15+,16+/m0/s1 |
| InChIKey | ITLWSALJNRJGFP-KPDYFYEGSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|