C10H8Cl4 — CID 595695
5,5,10,10-tetrachlorotricyclo[7.1.0.04,6]deca-2,7-diene (PubChem CID 595695) has the molecular formula C10H8Cl4 and a molecular weight of 269.99 g/mol. Its IUPAC name is 5,5,10,10-tetrachlorotricyclo[7.1.0.04,6]deca-2,7-diene.
| Compound Name | 5,5,10,10-tetrachlorotricyclo[7.1.0.04,6]deca-2,7-diene |
|---|---|
| PubChem CID | 595695 |
| Molecular Formula | C10H8Cl4 |
| Molecular Weight | 269.99 g/mol |
| Exact Mass | 267.94 |
| IUPAC Name | 5,5,10,10-tetrachlorotricyclo[7.1.0.04,6]deca-2,7-diene |
| SMILES | ClC1(Cl)C2C=CC3C(C=CC21)C3(Cl)Cl |
| InChI | InChI=1S/C10H8Cl4/c11-9(12)5-1-2-6-8(10(6,13)14)4-3-7(5)9/h1-8H |
| InChIKey | CIYBYUOLVCCXCO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.99 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|