C12H8Cl6 — CID 21116740
(1R,2S,3R,4S,5R,7R,8R)-3,4,5,6,6,7-hexachloropentacyclo[6.4.0.02,10.03,7.05,9]dodec-11-ene (PubChem CID 21116740) has the molecular formula C12H8Cl6 and a molecular weight of 364.91 g/mol. Its IUPAC name is (1R,2S,3R,4S,5R,7R,8R)-3,4,5,6,6,7-hexachloropentacyclo[6.4.0.02,10.03,7.05,9]dodec-11-ene.
| Compound Name | (1R,2S,3R,4S,5R,7R,8R)-3,4,5,6,6,7-hexachloropentacyclo[6.4.0.02,10.03,7.05,9]dodec-11-ene |
|---|---|
| PubChem CID | 21116740 |
| Molecular Formula | C12H8Cl6 |
| Molecular Weight | 364.91 g/mol |
| Exact Mass | 361.88 |
| IUPAC Name | (1R,2S,3R,4S,5R,7R,8R)-3,4,5,6,6,7-hexachloropentacyclo[6.4.0.02,10.03,7.05,9]dodec-11-ene |
| SMILES | Cl[C@H]1[C@]2(Cl)[C@H]3C4C=C[C@H]3[C@@H]3C4[C@]1(Cl)C(Cl)(Cl)[C@@]32Cl |
| InChI | InChI=1S/C12H8Cl6/c13-8-9(14)5-3-1-2-4(5)7-6(3)10(8,15)12(17,18)11(7,9)16/h1-8H/t3?,4-,5+,6?,7-,8+,9-,10-,11-/m1/s1 |
| InChIKey | IFADDOCOLDBCHI-RFSXQGIHSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.91 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|