C11H13Cl — CID 139981766
5-chlorotricyclo[6.2.1.02,7]undeca-3,9-diene (PubChem CID 139981766) has the molecular formula C11H13Cl and a molecular weight of 180.68 g/mol. Its IUPAC name is 5-chlorotricyclo[6.2.1.02,7]undeca-3,9-diene.
| Compound Name | 5-chlorotricyclo[6.2.1.02,7]undeca-3,9-diene |
|---|---|
| PubChem CID | 139981766 |
| Molecular Formula | C11H13Cl |
| Molecular Weight | 180.68 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 5-chlorotricyclo[6.2.1.02,7]undeca-3,9-diene |
| SMILES | ClC1C=CC2C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C11H13Cl/c12-9-3-4-10-7-1-2-8(5-7)11(10)6-9/h1-4,7-11H,5-6H2 |
| InChIKey | UHPTYKJSYPHIMZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|