C16H16N4 — CID 122418856
2-[3,7,8-tris(cyanomethyl)-2-bicyclo[2.2.2]oct-5-enyl]acetonitrile (PubChem CID 122418856) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-[3,7,8-tris(cyanomethyl)-2-bicyclo[2.2.2]oct-5-enyl]acetonitrile.
| Compound Name | 2-[3,7,8-tris(cyanomethyl)-2-bicyclo[2.2.2]oct-5-enyl]acetonitrile |
|---|---|
| PubChem CID | 122418856 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-[3,7,8-tris(cyanomethyl)-2-bicyclo[2.2.2]oct-5-enyl]acetonitrile |
| SMILES | N#CCC1C2C=CC(C1CC#N)C(CC#N)C2CC#N |
| InChI | InChI=1S/C16H16N4/c17-7-3-13-11-1-2-12(15(13)5-9-19)16(6-10-20)14(11)4-8-18/h1-2,11-16H,3-6H2 |
| InChIKey | QKCSSTOSLSAHRH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|