C9H13NO — CID 163876540
(6R)-3-aminotricyclo[4.2.1.02,5]non-7-en-3-ol (PubChem CID 163876540) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (6R)-3-aminotricyclo[4.2.1.02,5]non-7-en-3-ol.
| Compound Name | (6R)-3-aminotricyclo[4.2.1.02,5]non-7-en-3-ol |
|---|---|
| PubChem CID | 163876540 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (6R)-3-aminotricyclo[4.2.1.02,5]non-7-en-3-ol |
| SMILES | NC1(O)CC2C1C1C=C[C@H]2C1 |
| InChI | InChI=1S/C9H13NO/c10-9(11)4-7-5-1-2-6(3-5)8(7)9/h1-2,5-8,11H,3-4,10H2/t5-,6?,7?,8?,9?/m0/s1 |
| InChIKey | PPJMXOUZVBXJEU-OQOOARCMSA-N |
| XLogP | 0.48 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|