C11H10O2 — CID 124923045
(1S,4R,7R,10S)-tricyclo[5.2.1.04,10]deca-2,5,8-triene-2-carboxylic acid (PubChem CID 124923045) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is (1S,4R,7R,10S)-tricyclo[5.2.1.04,10]deca-2,5,8-triene-2-carboxylic acid.
| Compound Name | (1S,4R,7R,10S)-tricyclo[5.2.1.04,10]deca-2,5,8-triene-2-carboxylic acid |
|---|---|
| PubChem CID | 124923045 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (1S,4R,7R,10S)-tricyclo[5.2.1.04,10]deca-2,5,8-triene-2-carboxylic acid |
| SMILES | O=C(O)C1=C[C@@H]2C=C[C@@H]3C=C[C@H]1[C@@H]32 |
| InChI | InChI=1S/C11H10O2/c12-11(13)9-5-7-2-1-6-3-4-8(9)10(6)7/h1-8,10H,(H,12,13)/t6-,7+,8-,10+/m1/s1 |
| InChIKey | IQTLWVGPDBQIMN-JIOCBJNQSA-N |
| XLogP | 1.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|