C6H10O2 — CID 85423697
2-methylcyclopent-4-ene-1,3-diol (PubChem CID 85423697) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is 2-methylcyclopent-4-ene-1,3-diol.
| Compound Name | 2-methylcyclopent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 85423697 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 2-methylcyclopent-4-ene-1,3-diol |
| SMILES | CC1C(O)C=CC1O |
| InChI | InChI=1S/C6H10O2/c1-4-5(7)2-3-6(4)8/h2-8H,1H3 |
| InChIKey | DDHFYZFPMOTEBJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|