C5H10N2O — CID 148657615
2,3-dimethyl-1,3-dihydropyrazol-5-ol (PubChem CID 148657615) has the molecular formula C5H10N2O and a molecular weight of 114.15 g/mol. Its IUPAC name is 2,3-dimethyl-1,3-dihydropyrazol-5-ol.
| Compound Name | 2,3-dimethyl-1,3-dihydropyrazol-5-ol |
|---|---|
| PubChem CID | 148657615 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 2,3-dimethyl-1,3-dihydropyrazol-5-ol |
| SMILES | CC1C=C(O)NN1C |
| InChI | InChI=1S/C5H10N2O/c1-4-3-5(8)6-7(4)2/h3-4,6,8H,1-2H3 |
| InChIKey | NNDTZFKELPMJHM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |