C12H16O — CID 89150261
3-ethyl-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 89150261) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-ethyl-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | 3-ethyl-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 89150261 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-ethyl-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | CCC1Cc2ccccc2CC1O |
| InChI | InChI=1S/C12H16O/c1-2-9-7-10-5-3-4-6-11(10)8-12(9)13/h3-6,9,12-13H,2,7-8H2,1H3 |
| InChIKey | IRUKXZTUMVAOGA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |