C14H21N — CID 134490907
(1R,2S)-2-ethyl-N-propan-2-yl-2,3-dihydro-1H-inden-1-amine (PubChem CID 134490907) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (1R,2S)-2-ethyl-N-propan-2-yl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1R,2S)-2-ethyl-N-propan-2-yl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 134490907 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (1R,2S)-2-ethyl-N-propan-2-yl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CC[C@H]1Cc2ccccc2[C@@H]1NC(C)C |
| InChI | InChI=1S/C14H21N/c1-4-11-9-12-7-5-6-8-13(12)14(11)15-10(2)3/h5-8,10-11,14-15H,4,9H2,1-3H3/t11-,14+/m0/s1 |
| InChIKey | ICHKGKJEHWSFII-SMDDNHRTSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |