C15H22O — CID 62264698
2-(2-methylpentyl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 62264698) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-(2-methylpentyl)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 2-(2-methylpentyl)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 62264698 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2-(2-methylpentyl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | CCCC(C)CC1Cc2ccccc2C1O |
| InChI | InChI=1S/C15H22O/c1-3-6-11(2)9-13-10-12-7-4-5-8-14(12)15(13)16/h4-5,7-8,11,13,15-16H,3,6,9-10H2,1-2H3 |
| InChIKey | ZSSQIKOZGNNQGH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |