C11H14O — CID 130319265
(3R)-3-ethyl-3,4-dihydro-1H-isochromene (PubChem CID 130319265) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (3R)-3-ethyl-3,4-dihydro-1H-isochromene.
| Compound Name | (3R)-3-ethyl-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 130319265 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (3R)-3-ethyl-3,4-dihydro-1H-isochromene |
| SMILES | CC[C@@H]1Cc2ccccc2CO1 |
| InChI | InChI=1S/C11H14O/c1-2-11-7-9-5-3-4-6-10(9)8-12-11/h3-6,11H,2,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | FDTSMUWTTYMGKP-LLVKDONJSA-N |
| XLogP | 2.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |