C14H17N — CID 146244829
[4-(5-methylcyclohexa-1,3-dien-1-yl)phenyl]methanamine (PubChem CID 146244829) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is [4-(5-methylcyclohexa-1,3-dien-1-yl)phenyl]methanamine.
| Compound Name | [4-(5-methylcyclohexa-1,3-dien-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 146244829 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | [4-(5-methylcyclohexa-1,3-dien-1-yl)phenyl]methanamine |
| SMILES | CC1C=CC=C(c2ccc(CN)cc2)C1 |
| InChI | InChI=1S/C14H17N/c1-11-3-2-4-14(9-11)13-7-5-12(10-15)6-8-13/h2-8,11H,9-10,15H2,1H3 |
| InChIKey | XNTFZHWXNCBVKA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |